C35H36F4N6O3 — CID 135520546
N-[(Z)-N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-2-phenylacetamide;2-phenyl-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile (PubChem CID 135520546) has the molecular formula C35H36F4N6O3 and a molecular weight of 664.70 g/mol. Its IUPAC name is N-[(Z)-N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-2-phenylacetamide;2-phenyl-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile.
| Compound Name | N-[(Z)-N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-2-phenylacetamide;2-phenyl-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile |
|---|---|
| PubChem CID | 135520546 |
| Molecular Formula | C35H36F4N6O3 |
| Molecular Weight | 664.70 g/mol |
| Exact Mass | 664.28 |
| IUPAC Name | N-[(Z)-N-(cyclopropylmethoxy)-C-[6-(difluoromethoxy)-2,3-difluorophenyl]carbonimidoyl]-2-phenylacetamide;2-phenyl-2-(1,2,4-triazol-1-ylmethyl)hexanenitrile |
| SMILES | CCCCC(C#N)(Cn1cncn1)c1ccccc1.O=C(Cc1ccccc1)N/C(=N\OCC1CC1)c1c(OC(F)F)ccc(F)c1F |
| InChI | InChI=1S/C20H18F4N2O3.C15H18N4/c21-14-8-9-15(29-20(23)24)17(18(14)22)19(26-28-11-13-6-7-13)25-16(27)10-12-4-2-1-3-5-12;1-2-3-9-15(10-16,11-19-13-17-12-18-19)14-7-5-4-6-8-14/h1-5,8-9,13,20H,6-7,10-11H2,(H,25,26,27);4-8,12-13H,2-3,9,11H2,1H3 |
| InChIKey | YUPFJFUMMAWFAF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|