C22H24F4N2O2 — CID 142889486
N-[(Z)-N-(cyclopropylmethoxy)-C-[6-fluoro-3,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]carbonimidoyl]-2-phenylacetamide (PubChem CID 142889486) has the molecular formula C22H24F4N2O2 and a molecular weight of 424.44 g/mol. Its IUPAC name is N-[(Z)-N-(cyclopropylmethoxy)-C-[6-fluoro-3,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]carbonimidoyl]-2-phenylacetamide.
| Compound Name | N-[(Z)-N-(cyclopropylmethoxy)-C-[6-fluoro-3,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]carbonimidoyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 142889486 |
| Molecular Formula | C22H24F4N2O2 |
| Molecular Weight | 424.44 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | N-[(Z)-N-(cyclopropylmethoxy)-C-[6-fluoro-3,5-dimethyl-2-(trifluoromethyl)cyclohexa-1,5-dien-1-yl]carbonimidoyl]-2-phenylacetamide |
| SMILES | CC1=C(F)C(/C(=N/OCC2CC2)NC(=O)Cc2ccccc2)=C(C(F)(F)F)C(C)C1 |
| InChI | InChI=1S/C22H24F4N2O2/c1-13-10-14(2)20(23)18(19(13)22(24,25)26)21(28-30-12-16-8-9-16)27-17(29)11-15-6-4-3-5-7-15/h3-7,13,16H,8-12H2,1-2H3,(H,27,28,29) |
| InChIKey | WGGDDBCFHCFWAU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.44 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|