C20H15F5N2O2 — CID 137100440
2-cyclohexa-1,5-dien-3-yn-1-yl-N-[(Z)-N-(cyclopropylmethoxy)-C-[2,3-difluoro-6-(trifluoromethyl)phenyl]carbonimidoyl]acetamide (PubChem CID 137100440) has the molecular formula C20H15F5N2O2 and a molecular weight of 410.34 g/mol. Its IUPAC name is 2-cyclohexa-1,5-dien-3-yn-1-yl-N-[(Z)-N-(cyclopropylmethoxy)-C-[2,3-difluoro-6-(trifluoromethyl)phenyl]carbonimidoyl]acetamide.
| Compound Name | 2-cyclohexa-1,5-dien-3-yn-1-yl-N-[(Z)-N-(cyclopropylmethoxy)-C-[2,3-difluoro-6-(trifluoromethyl)phenyl]carbonimidoyl]acetamide |
|---|---|
| PubChem CID | 137100440 |
| Molecular Formula | C20H15F5N2O2 |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-cyclohexa-1,5-dien-3-yn-1-yl-N-[(Z)-N-(cyclopropylmethoxy)-C-[2,3-difluoro-6-(trifluoromethyl)phenyl]carbonimidoyl]acetamide |
| SMILES | O=C(Cc1cc#ccc1)N/C(=N\OCC1CC1)c1c(C(F)(F)F)ccc(F)c1F |
| InChI | InChI=1S/C20H15F5N2O2/c21-15-9-8-14(20(23,24)25)17(18(15)22)19(27-29-11-13-6-7-13)26-16(28)10-12-4-2-1-3-5-12/h2,4-5,8-9,13H,6-7,10-11H2,(H,26,27,28) |
| InChIKey | VGQHZPJQFIDXPI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|