C14H33NO7Si — CID 173058176
3-[1,1,2-tris(1-methoxyethoxy)ethoxysilyl]propan-1-amine (PubChem CID 173058176) has the molecular formula C14H33NO7Si and a molecular weight of 355.50 g/mol. Its IUPAC name is 3-[1,1,2-tris(1-methoxyethoxy)ethoxysilyl]propan-1-amine.
| Compound Name | 3-[1,1,2-tris(1-methoxyethoxy)ethoxysilyl]propan-1-amine |
|---|---|
| PubChem CID | 173058176 |
| Molecular Formula | C14H33NO7Si |
| Molecular Weight | 355.50 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 3-[1,1,2-tris(1-methoxyethoxy)ethoxysilyl]propan-1-amine |
| SMILES | COC(C)OCC(O[SiH2]CCCN)(OC(C)OC)OC(C)OC |
| InChI | InChI=1S/C14H33NO7Si/c1-11(16-4)19-10-14(20-12(2)17-5,21-13(3)18-6)22-23-9-7-8-15/h11-13H,7-10,15,23H2,1-6H3 |
| InChIKey | SNJIVZHLWSHGIT-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.50 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|