C10H11F3N+ — CID 173058275
7-(trifluoromethyl)-2,3,4,4a-tetrahydroquinolin-1-ium (PubChem CID 173058275) has the molecular formula C10H11F3N+ and a molecular weight of 202.20 g/mol. Its IUPAC name is 7-(trifluoromethyl)-2,3,4,4a-tetrahydroquinolin-1-ium.
| Compound Name | 7-(trifluoromethyl)-2,3,4,4a-tetrahydroquinolin-1-ium |
|---|---|
| PubChem CID | 173058275 |
| Molecular Formula | C10H11F3N+ |
| Molecular Weight | 202.20 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 7-(trifluoromethyl)-2,3,4,4a-tetrahydroquinolin-1-ium |
| SMILES | FC(F)(F)C1=CC2=[NH+]CCCC2C=C1 |
| InChI | InChI=1S/C10H10F3N/c11-10(12,13)8-4-3-7-2-1-5-14-9(7)6-8/h3-4,6-7H,1-2,5H2/p+1 |
| InChIKey | GPUXRQWTBRJRDB-UHFFFAOYSA-O |
| XLogP | 0.98 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |