C8H21ClN2Si — CID 173059198
1-chloro-1-N-ethyl-1-N',1-N',2-trimethyl-2-silylpropane-1,1-diamine (PubChem CID 173059198) has the molecular formula C8H21ClN2Si and a molecular weight of 208.81 g/mol. Its IUPAC name is 1-chloro-1-N-ethyl-1-N',1-N',2-trimethyl-2-silylpropane-1,1-diamine.
| Compound Name | 1-chloro-1-N-ethyl-1-N',1-N',2-trimethyl-2-silylpropane-1,1-diamine |
|---|---|
| PubChem CID | 173059198 |
| Molecular Formula | C8H21ClN2Si |
| Molecular Weight | 208.81 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-chloro-1-N-ethyl-1-N',1-N',2-trimethyl-2-silylpropane-1,1-diamine |
| SMILES | CCNC(Cl)(N(C)C)C(C)(C)[SiH3] |
| InChI | InChI=1S/C8H21ClN2Si/c1-6-10-8(9,11(4)5)7(2,3)12/h10H,6H2,1-5,12H3 |
| InChIKey | GERAIOYVGXUVPX-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.81 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|