C9H22ClNSi — CID 173064950
1-chloro-N,N-diethyl-2,2-dimethyl-1-silylpropan-1-amine (PubChem CID 173064950) has the molecular formula C9H22ClNSi and a molecular weight of 207.82 g/mol. Its IUPAC name is 1-chloro-N,N-diethyl-2,2-dimethyl-1-silylpropan-1-amine.
| Compound Name | 1-chloro-N,N-diethyl-2,2-dimethyl-1-silylpropan-1-amine |
|---|---|
| PubChem CID | 173064950 |
| Molecular Formula | C9H22ClNSi |
| Molecular Weight | 207.82 g/mol |
| Exact Mass | 207.12 |
| IUPAC Name | 1-chloro-N,N-diethyl-2,2-dimethyl-1-silylpropan-1-amine |
| SMILES | CCN(CC)C([SiH3])(Cl)C(C)(C)C |
| InChI | InChI=1S/C9H22ClNSi/c1-6-11(7-2)9(10,12)8(3,4)5/h6-7H2,1-5,12H3 |
| InChIKey | OCEXSVHEUOTYAN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.82 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|