C7H18ClNSi — CID 173064764
1-chloro-N,N,2,2-tetramethyl-1-silylpropan-1-amine (PubChem CID 173064764) has the molecular formula C7H18ClNSi and a molecular weight of 179.77 g/mol. Its IUPAC name is 1-chloro-N,N,2,2-tetramethyl-1-silylpropan-1-amine.
| Compound Name | 1-chloro-N,N,2,2-tetramethyl-1-silylpropan-1-amine |
|---|---|
| PubChem CID | 173064764 |
| Molecular Formula | C7H18ClNSi |
| Molecular Weight | 179.77 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-chloro-N,N,2,2-tetramethyl-1-silylpropan-1-amine |
| SMILES | CN(C)C([SiH3])(Cl)C(C)(C)C |
| InChI | InChI=1S/C7H18ClNSi/c1-6(2,3)7(8,10)9(4)5/h1-5,10H3 |
| InChIKey | IHUVXPXENMHATR-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.77 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|