C14H35N3Si — CID 173059218
1-N"-butyl-1-N,1-N,1-N',1-N'-tetraethyl-1-N"-silylethane-1,1,1-triamine (PubChem CID 173059218) has the molecular formula C14H35N3Si and a molecular weight of 273.54 g/mol. Its IUPAC name is 1-N"-butyl-1-N,1-N,1-N',1-N'-tetraethyl-1-N"-silylethane-1,1,1-triamine.
| Compound Name | 1-N"-butyl-1-N,1-N,1-N',1-N'-tetraethyl-1-N"-silylethane-1,1,1-triamine |
|---|---|
| PubChem CID | 173059218 |
| Molecular Formula | C14H35N3Si |
| Molecular Weight | 273.54 g/mol |
| Exact Mass | 273.26 |
| IUPAC Name | 1-N"-butyl-1-N,1-N,1-N',1-N'-tetraethyl-1-N"-silylethane-1,1,1-triamine |
| SMILES | CCCCN([SiH3])C(C)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C14H35N3Si/c1-7-12-13-17(18)14(6,15(8-2)9-3)16(10-4)11-5/h7-13H2,1-6,18H3 |
| InChIKey | BZZQIHRNYVAHFD-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.54 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|