C13H20ClNO3 — CID 173061296
[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino] 7-chlorohept-2-enoate (PubChem CID 173061296) has the molecular formula C13H20ClNO3 and a molecular weight of 273.76 g/mol. Its IUPAC name is [[(1S)-2,2-dimethylcyclopropanecarbonyl]amino] 7-chlorohept-2-enoate.
| Compound Name | [[(1S)-2,2-dimethylcyclopropanecarbonyl]amino] 7-chlorohept-2-enoate |
|---|---|
| PubChem CID | 173061296 |
| Molecular Formula | C13H20ClNO3 |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | [[(1S)-2,2-dimethylcyclopropanecarbonyl]amino] 7-chlorohept-2-enoate |
| SMILES | CC1(C)C[C@@H]1C(=O)NOC(=O)C=CCCCCCl |
| InChI | InChI=1S/C13H20ClNO3/c1-13(2)9-10(13)12(17)15-18-11(16)7-5-3-4-6-8-14/h5,7,10H,3-4,6,8-9H2,1-2H3,(H,15,17)/t10-/m1/s1 |
| InChIKey | ADMJDDMQVSIIBU-SNVBAGLBSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|