C15H24ClNO3 — CID 67298182
ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate (PubChem CID 67298182) has the molecular formula C15H24ClNO3 and a molecular weight of 301.81 g/mol. Its IUPAC name is ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate.
| Compound Name | ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 67298182 |
| Molecular Formula | C15H24ClNO3 |
| Molecular Weight | 301.81 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | ethyl (E)-7-chloro-2-[[(1S)-2,2-dimethylcyclopropanecarbonyl]amino]hept-2-enoate |
| SMILES | CCOC(=O)/C(=C\CCCCCl)NC(=O)[C@H]1CC1(C)C |
| InChI | InChI=1S/C15H24ClNO3/c1-4-20-14(19)12(8-6-5-7-9-16)17-13(18)11-10-15(11,2)3/h8,11H,4-7,9-10H2,1-3H3,(H,17,18)/b12-8+/t11-/m1/s1 |
| InChIKey | NMWDFGOLTYRZMD-OYGDSYQHSA-N |
| XLogP | 3.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|