C17H30N2O4 — CID 67919647
2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-(3-hydroxypropylamino)oct-2-enoic acid (PubChem CID 67919647) has the molecular formula C17H30N2O4 and a molecular weight of 326.44 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-(3-hydroxypropylamino)oct-2-enoic acid.
| Compound Name | 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-(3-hydroxypropylamino)oct-2-enoic acid |
|---|---|
| PubChem CID | 67919647 |
| Molecular Formula | C17H30N2O4 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-(3-hydroxypropylamino)oct-2-enoic acid |
| SMILES | CC1(C)CC1C(=O)NC(=CCCCCCNCCCO)C(=O)O |
| InChI | InChI=1S/C17H30N2O4/c1-17(2)12-13(17)15(21)19-14(16(22)23)8-5-3-4-6-9-18-10-7-11-20/h8,13,18,20H,3-7,9-12H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | YQTWOKVSOKDCHK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|