C13H21NO6S — CID 57285940
2-[(2,2-dimethylcyclopropanecarbonyl)amino]-7-sulfohept-2-enoic acid (PubChem CID 57285940) has the molecular formula C13H21NO6S and a molecular weight of 319.38 g/mol. Its IUPAC name is 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-7-sulfohept-2-enoic acid.
| Compound Name | 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-7-sulfohept-2-enoic acid |
|---|---|
| PubChem CID | 57285940 |
| Molecular Formula | C13H21NO6S |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[(2,2-dimethylcyclopropanecarbonyl)amino]-7-sulfohept-2-enoic acid |
| SMILES | CC1(C)CC1C(=O)NC(=CCCCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21NO6S/c1-13(2)8-9(13)11(15)14-10(12(16)17)6-4-3-5-7-21(18,19)20/h6,9H,3-5,7-8H2,1-2H3,(H,14,15)(H,16,17)(H,18,19,20) |
| InChIKey | JLUOBYPMAVWSPY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|