C14H23NO6S — CID 88509511
(Z)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-sulfooct-2-enoic acid (PubChem CID 88509511) has the molecular formula C14H23NO6S and a molecular weight of 333.41 g/mol. Its IUPAC name is (Z)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-sulfooct-2-enoic acid.
| Compound Name | (Z)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-sulfooct-2-enoic acid |
|---|---|
| PubChem CID | 88509511 |
| Molecular Formula | C14H23NO6S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (Z)-2-[(2,2-dimethylcyclopropanecarbonyl)amino]-8-sulfooct-2-enoic acid |
| SMILES | CC1(C)CC1C(=O)N/C(=C\CCCCCS(=O)(=O)O)C(=O)O |
| InChI | InChI=1S/C14H23NO6S/c1-14(2)9-10(14)12(16)15-11(13(17)18)7-5-3-4-6-8-22(19,20)21/h7,10H,3-6,8-9H2,1-2H3,(H,15,16)(H,17,18)(H,19,20,21)/b11-7- |
| InChIKey | PCEUOBWEFSGFJJ-XFFZJAGNSA-N |
| XLogP | 1.57 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|