C12H17Cl2NO3 — CID 54023373
2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid (PubChem CID 54023373) has the molecular formula C12H17Cl2NO3 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid.
| Compound Name | 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid |
|---|---|
| PubChem CID | 54023373 |
| Molecular Formula | C12H17Cl2NO3 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid |
| SMILES | CCCCCC=C(NC(=O)C1CC1(Cl)Cl)C(=O)O |
| InChI | InChI=1S/C12H17Cl2NO3/c1-2-3-4-5-6-9(11(17)18)15-10(16)8-7-12(8,13)14/h6,8H,2-5,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | LALWXKAEURAMAW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|