2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid

C12H17Cl2NO3 — CID 54023373

IUPAC2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid
SMILESCCCCCC=C(NC(=O)C1CC1(Cl)Cl)C(=O)O
InChIInChI=1S/C12H17Cl2NO3/c1-2-3-4-5-6-9(11(17)18)15-10(16)8-7-12(8,13)14/h6,8H,2-5,7H2,1H3,(H,15,16)(H,17,18)
InChIKeyLALWXKAEURAMAW-UHFFFAOYSA-N
MW294.18 g/mol
LogP2.85
Rot. Bonds7

About 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid

2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid (PubChem CID 54023373) has the molecular formula C12H17Cl2NO3 and a molecular weight of 294.18 g/mol. Its IUPAC name is 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid.

Molecular Properties

Compound Name2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid
PubChem CID54023373
Molecular FormulaC12H17Cl2NO3
Molecular Weight294.18 g/mol
Exact Mass293.06
IUPAC Name2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid
SMILESCCCCCC=C(NC(=O)C1CC1(Cl)Cl)C(=O)O
InChIInChI=1S/C12H17Cl2NO3/c1-2-3-4-5-6-9(11(17)18)15-10(16)8-7-12(8,13)14/h6,8H,2-5,7H2,1H3,(H,15,16)(H,17,18)
InChIKeyLALWXKAEURAMAW-UHFFFAOYSA-N
XLogP2.85
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds7
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500294.18
LogP ≤ 52.85
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid?
The IUPAC name of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid (CID 54023373) is 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid.
What is the SMILES notation for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid?
The canonical SMILES for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid is CCCCCC=C(NC(=O)C1CC1(Cl)Cl)C(=O)O.
What is the InChIKey of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid?
The InChIKey is LALWXKAEURAMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17Cl2NO3/c1-2-3-4-5-6-9(11(17)18)15-10(16)8-7-12(8,13)14/h6,8H,2-5,7H2,1H3,(H,15,16)(H,17,18).
What are the key properties of 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid?
2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid has a molecular weight of 294.18 g/mol, XLogP of 2.85, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,2-dichlorocyclopropanecarbonyl)amino]oct-2-enoic acid is sourced from PubChem (CID 54023373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).