C27H41NO3 — CID 175974369
(pentanoylamino) docosa-2,4,6,8,10,12-hexaenoate (PubChem CID 175974369) has the molecular formula C27H41NO3 and a molecular weight of 427.63 g/mol. Its IUPAC name is (pentanoylamino) docosa-2,4,6,8,10,12-hexaenoate.
| Compound Name | (pentanoylamino) docosa-2,4,6,8,10,12-hexaenoate |
|---|---|
| PubChem CID | 175974369 |
| Molecular Formula | C27H41NO3 |
| Molecular Weight | 427.63 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | (pentanoylamino) docosa-2,4,6,8,10,12-hexaenoate |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)ONC(=O)CCCC |
| InChI | InChI=1S/C27H41NO3/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-25-27(30)31-28-26(29)24-6-4-2/h13-23,25H,3-12,24H2,1-2H3,(H,28,29) |
| InChIKey | ANZWHLKMZVORDX-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.63 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|