C33H71N3Si — CID 173061517
1-N,1-N,1-N',1-N',2-N,2-N-hexapentyl-1-silylprop-2-ene-1,1,2-triamine (PubChem CID 173061517) has the molecular formula C33H71N3Si and a molecular weight of 538.04 g/mol. Its IUPAC name is 1-N,1-N,1-N',1-N',2-N,2-N-hexapentyl-1-silylprop-2-ene-1,1,2-triamine.
| Compound Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexapentyl-1-silylprop-2-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 173061517 |
| Molecular Formula | C33H71N3Si |
| Molecular Weight | 538.04 g/mol |
| Exact Mass | 537.54 |
| IUPAC Name | 1-N,1-N,1-N',1-N',2-N,2-N-hexapentyl-1-silylprop-2-ene-1,1,2-triamine |
| SMILES | C=C(N(CCCCC)CCCCC)C([SiH3])(N(CCCCC)CCCCC)N(CCCCC)CCCCC |
| InChI | InChI=1S/C33H71N3Si/c1-8-14-20-26-34(27-21-15-9-2)32(7)33(37,35(28-22-16-10-3)29-23-17-11-4)36(30-24-18-12-5)31-25-19-13-6/h7-31H2,1-6,37H3 |
| InChIKey | QLGNZJXWEUDJSW-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.04 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|