C10H16Cl3N3O3 — CID 173065374
3-(2-amino-1-chloro-2-oxoethyl)-2,4-dichloro-3-propan-2-ylpentanediamide (PubChem CID 173065374) has the molecular formula C10H16Cl3N3O3 and a molecular weight of 332.62 g/mol. Its IUPAC name is 3-(2-amino-1-chloro-2-oxoethyl)-2,4-dichloro-3-propan-2-ylpentanediamide.
| Compound Name | 3-(2-amino-1-chloro-2-oxoethyl)-2,4-dichloro-3-propan-2-ylpentanediamide |
|---|---|
| PubChem CID | 173065374 |
| Molecular Formula | C10H16Cl3N3O3 |
| Molecular Weight | 332.62 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-(2-amino-1-chloro-2-oxoethyl)-2,4-dichloro-3-propan-2-ylpentanediamide |
| SMILES | CC(C)C(C(Cl)C(N)=O)(C(Cl)C(N)=O)C(Cl)C(N)=O |
| InChI | InChI=1S/C10H16Cl3N3O3/c1-3(2)10(4(11)7(14)17,5(12)8(15)18)6(13)9(16)19/h3-6H,1-2H3,(H2,14,17)(H2,15,18)(H2,16,19) |
| InChIKey | NQLJSGRVXGDUBJ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 129.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.62 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|