About 2-phosphorosopropanamide
2-phosphorosopropanamide (PubChem CID 174589319) has the molecular formula C3H6NO2P
and a molecular weight of 119.06 g/mol. Its IUPAC name is 2-phosphorosopropanamide.
Molecular Properties
| Compound Name | 2-phosphorosopropanamide |
| PubChem CID | 174589319 |
| Molecular Formula | C3H6NO2P |
| Molecular Weight | 119.06 g/mol |
| Exact Mass | 119.01 |
| IUPAC Name | 2-phosphorosopropanamide |
| SMILES | CC(P=O)C(N)=O |
| InChI | InChI=1S/C3H6NO2P/c1-2(7-6)3(4)5/h2H,1H3,(H2,4,5) |
| InChIKey | GFZJYPFFZYGUIG-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.06 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-phosphorosopropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phosphorosopropanamide?
The IUPAC name of 2-phosphorosopropanamide (CID 174589319) is 2-phosphorosopropanamide.
What is the SMILES notation for 2-phosphorosopropanamide?
The canonical SMILES for 2-phosphorosopropanamide is CC(P=O)C(N)=O.
What is the InChIKey of 2-phosphorosopropanamide?
The InChIKey is GFZJYPFFZYGUIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NO2P/c1-2(7-6)3(4)5/h2H,1H3,(H2,4,5).
What are the key properties of 2-phosphorosopropanamide?
2-phosphorosopropanamide has a molecular weight of 119.06 g/mol, XLogP of 0.15, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phosphorosopropanamide is sourced from PubChem (CID 174589319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).