C9H19ClMgN+ — CID 173066007
magnesium;2,2,6,6-tetramethylpiperidine;chloride (PubChem CID 173066007) has the molecular formula C9H19ClMgN+ and a molecular weight of 201.02 g/mol. Its IUPAC name is magnesium;2,2,6,6-tetramethylpiperidine;chloride.
| Compound Name | magnesium;2,2,6,6-tetramethylpiperidine;chloride |
|---|---|
| PubChem CID | 173066007 |
| Molecular Formula | C9H19ClMgN+ |
| Molecular Weight | 201.02 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | magnesium;2,2,6,6-tetramethylpiperidine;chloride |
| SMILES | CC1(C)CCCC(C)(C)N1.[Cl-].[Mg+2] |
| InChI | InChI=1S/C9H19N.ClH.Mg/c1-8(2)6-5-7-9(3,4)10-8;;/h10H,5-7H2,1-4H3;1H;/q;;+2/p-1 |
| InChIKey | VFIKSIWVLUXSHZ-UHFFFAOYSA-M |
| XLogP | -1.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.02 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |