C13H22N2O2 — CID 161421450
pyrrole-2,5-dione;2,2,6,6-tetramethylpiperidine (PubChem CID 161421450) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is pyrrole-2,5-dione;2,2,6,6-tetramethylpiperidine.
| Compound Name | pyrrole-2,5-dione;2,2,6,6-tetramethylpiperidine |
|---|---|
| PubChem CID | 161421450 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | pyrrole-2,5-dione;2,2,6,6-tetramethylpiperidine |
| SMILES | CC1(C)CCCC(C)(C)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C9H19N.C4H3NO2/c1-8(2)6-5-7-9(3,4)10-8;6-3-1-2-4(7)5-3/h10H,5-7H2,1-4H3;1-2H,(H,5,6,7) |
| InChIKey | VWUGBRNISFOPTM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|