C6H9NO4 — CID 129050540
ethane-1,1-diol;pyrrole-2,5-dione (PubChem CID 129050540) has the molecular formula C6H9NO4 and a molecular weight of 159.14 g/mol. Its IUPAC name is ethane-1,1-diol;pyrrole-2,5-dione.
| Compound Name | ethane-1,1-diol;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 129050540 |
| Molecular Formula | C6H9NO4 |
| Molecular Weight | 159.14 g/mol |
| Exact Mass | 159.05 |
| IUPAC Name | ethane-1,1-diol;pyrrole-2,5-dione |
| SMILES | CC(O)O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C2H6O2/c6-3-1-2-4(7)5-3;1-2(3)4/h1-2H,(H,5,6,7);2-4H,1H3 |
| InChIKey | BSOPVGSHXFYMJI-UHFFFAOYSA-N |
| XLogP | -1.48 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.14 |
| LogP ≤ 5 | -1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|