C4H4NNaO2 — CID 173235296
sodium;hydride;pyrrole-2,5-dione (PubChem CID 173235296) has the molecular formula C4H4NNaO2 and a molecular weight of 121.07 g/mol. Its IUPAC name is sodium;hydride;pyrrole-2,5-dione.
| Compound Name | sodium;hydride;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 173235296 |
| Molecular Formula | C4H4NNaO2 |
| Molecular Weight | 121.07 g/mol |
| Exact Mass | 121.01 |
| IUPAC Name | sodium;hydride;pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1.[H-].[Na+] |
| InChI | InChI=1S/C4H3NO2.Na.H/c6-3-1-2-4(7)5-3;;/h1-2H,(H,5,6,7);;/q;+1;-1 |
| InChIKey | JTBOJDZVQBLUCU-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.07 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|