About oxomethylidenehydrazine;pyrrole-2,5-dione
oxomethylidenehydrazine;pyrrole-2,5-dione (PubChem CID 158643805) has the molecular formula C5H5N3O3
and a molecular weight of 155.11 g/mol. Its IUPAC name is oxomethylidenehydrazine;pyrrole-2,5-dione.
Molecular Properties
| Compound Name | oxomethylidenehydrazine;pyrrole-2,5-dione |
| PubChem CID | 158643805 |
| Molecular Formula | C5H5N3O3 |
| Molecular Weight | 155.11 g/mol |
| Exact Mass | 155.03 |
| IUPAC Name | oxomethylidenehydrazine;pyrrole-2,5-dione |
| SMILES | NN=C=O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.CH2N2O/c6-3-1-2-4(7)5-3;2-3-1-4/h1-2H,(H,5,6,7);2H2 |
| InChIKey | IASFPQSBSBTKCL-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.11 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze oxomethylidenehydrazine;pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxomethylidenehydrazine;pyrrole-2,5-dione?
The IUPAC name of oxomethylidenehydrazine;pyrrole-2,5-dione (CID 158643805) is oxomethylidenehydrazine;pyrrole-2,5-dione.
What is the SMILES notation for oxomethylidenehydrazine;pyrrole-2,5-dione?
The canonical SMILES for oxomethylidenehydrazine;pyrrole-2,5-dione is NN=C=O.O=C1C=CC(=O)N1.
What is the InChIKey of oxomethylidenehydrazine;pyrrole-2,5-dione?
The InChIKey is IASFPQSBSBTKCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO2.CH2N2O/c6-3-1-2-4(7)5-3;2-3-1-4/h1-2H,(H,5,6,7);2H2.
What are the key properties of oxomethylidenehydrazine;pyrrole-2,5-dione?
oxomethylidenehydrazine;pyrrole-2,5-dione has a molecular weight of 155.11 g/mol, XLogP of -1.61, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for oxomethylidenehydrazine;pyrrole-2,5-dione is sourced from PubChem (CID 158643805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).