About sodium;pyrrole-2,5-dione;acetate
sodium;pyrrole-2,5-dione;acetate (PubChem CID 174944502) has the molecular formula C6H6NNaO4
and a molecular weight of 179.11 g/mol. Its IUPAC name is sodium;pyrrole-2,5-dione;acetate.
Molecular Properties
| Compound Name | sodium;pyrrole-2,5-dione;acetate |
| PubChem CID | 174944502 |
| Molecular Formula | C6H6NNaO4 |
| Molecular Weight | 179.11 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | sodium;pyrrole-2,5-dione;acetate |
| SMILES | CC(=O)[O-].O=C1C=CC(=O)N1.[Na+] |
| InChI | InChI=1S/C4H3NO2.C2H4O2.Na/c6-3-1-2-4(7)5-3;1-2(3)4;/h1-2H,(H,5,6,7);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | LOBXCROLOSQYBB-UHFFFAOYSA-M |
| XLogP | -5.04 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.11 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze sodium;pyrrole-2,5-dione;acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;pyrrole-2,5-dione;acetate?
The IUPAC name of sodium;pyrrole-2,5-dione;acetate (CID 174944502) is sodium;pyrrole-2,5-dione;acetate.
What is the SMILES notation for sodium;pyrrole-2,5-dione;acetate?
The canonical SMILES for sodium;pyrrole-2,5-dione;acetate is CC(=O)[O-].O=C1C=CC(=O)N1.[Na+].
What is the InChIKey of sodium;pyrrole-2,5-dione;acetate?
The InChIKey is LOBXCROLOSQYBB-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H3NO2.C2H4O2.Na/c6-3-1-2-4(7)5-3;1-2(3)4;/h1-2H,(H,5,6,7);1H3,(H,3,4);/q;;+1/p-1.
What are the key properties of sodium;pyrrole-2,5-dione;acetate?
sodium;pyrrole-2,5-dione;acetate has a molecular weight of 179.11 g/mol, XLogP of -5.04, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;pyrrole-2,5-dione;acetate is sourced from PubChem (CID 174944502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).