C6H6NNaO4 — CID 174944502
sodium;pyrrole-2,5-dione;acetate (PubChem CID 174944502) has the molecular formula C6H6NNaO4 and a molecular weight of 179.11 g/mol. Its IUPAC name is sodium;pyrrole-2,5-dione;acetate.
| Compound Name | sodium;pyrrole-2,5-dione;acetate |
|---|---|
| PubChem CID | 174944502 |
| Molecular Formula | C6H6NNaO4 |
| Molecular Weight | 179.11 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | sodium;pyrrole-2,5-dione;acetate |
| SMILES | CC(=O)[O-].O=C1C=CC(=O)N1.[Na+] |
| InChI | InChI=1S/C4H3NO2.C2H4O2.Na/c6-3-1-2-4(7)5-3;1-2(3)4;/h1-2H,(H,5,6,7);1H3,(H,3,4);/q;;+1/p-1 |
| InChIKey | LOBXCROLOSQYBB-UHFFFAOYSA-M |
| XLogP | -5.04 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.11 |
| LogP ≤ 5 | -5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|