C7H8ClNO3 — CID 71339860
propanoyl chloride;pyrrole-2,5-dione (PubChem CID 71339860) has the molecular formula C7H8ClNO3 and a molecular weight of 189.60 g/mol. Its IUPAC name is propanoyl chloride;pyrrole-2,5-dione.
| Compound Name | propanoyl chloride;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 71339860 |
| Molecular Formula | C7H8ClNO3 |
| Molecular Weight | 189.60 g/mol |
| Exact Mass | 189.02 |
| IUPAC Name | propanoyl chloride;pyrrole-2,5-dione |
| SMILES | CCC(=O)Cl.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C3H5ClO/c6-3-1-2-4(7)5-3;1-2-3(4)5/h1-2H,(H,5,6,7);2H2,1H3 |
| InChIKey | BTACLXSJLISKBZ-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.60 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|