C7H8BrNO4 — CID 131740615
2-bromopropanoic acid;pyrrole-2,5-dione (PubChem CID 131740615) has the molecular formula C7H8BrNO4 and a molecular weight of 250.05 g/mol. Its IUPAC name is 2-bromopropanoic acid;pyrrole-2,5-dione.
| Compound Name | 2-bromopropanoic acid;pyrrole-2,5-dione |
|---|---|
| PubChem CID | 131740615 |
| Molecular Formula | C7H8BrNO4 |
| Molecular Weight | 250.05 g/mol |
| Exact Mass | 248.96 |
| IUPAC Name | 2-bromopropanoic acid;pyrrole-2,5-dione |
| SMILES | CC(Br)C(=O)O.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/C4H3NO2.C3H5BrO2/c6-3-1-2-4(7)5-3;1-2(4)3(5)6/h1-2H,(H,5,6,7);2H,1H3,(H,5,6) |
| InChIKey | QFRAJEHOHQXKQQ-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.05 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|