C15H29N3O5 — CID 173067222
[2-(N'-hydroxycarbamimidoyl)-5,5-dimethyl-6-(oxan-2-yloxy)hexyl]carbamic acid (PubChem CID 173067222) has the molecular formula C15H29N3O5 and a molecular weight of 331.41 g/mol. Its IUPAC name is [2-(N'-hydroxycarbamimidoyl)-5,5-dimethyl-6-(oxan-2-yloxy)hexyl]carbamic acid.
| Compound Name | [2-(N'-hydroxycarbamimidoyl)-5,5-dimethyl-6-(oxan-2-yloxy)hexyl]carbamic acid |
|---|---|
| PubChem CID | 173067222 |
| Molecular Formula | C15H29N3O5 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.21 |
| IUPAC Name | [2-(N'-hydroxycarbamimidoyl)-5,5-dimethyl-6-(oxan-2-yloxy)hexyl]carbamic acid |
| SMILES | CC(C)(CCC(CNC(=O)O)C(N)=NO)COC1CCCCO1 |
| InChI | InChI=1S/C15H29N3O5/c1-15(2,10-23-12-5-3-4-8-22-12)7-6-11(13(16)18-21)9-17-14(19)20/h11-12,17,21H,3-10H2,1-2H3,(H2,16,18)(H,19,20) |
| InChIKey | XBMMDLKXAMUSED-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 126.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|