C19H37N3O5 — CID 86640586
tert-butyl N-[(1E)-1-amino-1-hydroxyimino-5,5-dimethyl-6-(oxan-2-yloxy)hexan-2-yl]-N-methylcarbamate (PubChem CID 86640586) has the molecular formula C19H37N3O5 and a molecular weight of 387.52 g/mol. Its IUPAC name is tert-butyl N-[(1E)-1-amino-1-hydroxyimino-5,5-dimethyl-6-(oxan-2-yloxy)hexan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[(1E)-1-amino-1-hydroxyimino-5,5-dimethyl-6-(oxan-2-yloxy)hexan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 86640586 |
| Molecular Formula | C19H37N3O5 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.27 |
| IUPAC Name | tert-butyl N-[(1E)-1-amino-1-hydroxyimino-5,5-dimethyl-6-(oxan-2-yloxy)hexan-2-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)OC(C)(C)C)C(CCC(C)(C)COC1CCCCO1)/C(N)=N\O |
| InChI | InChI=1S/C19H37N3O5/c1-18(2,3)27-17(23)22(6)14(16(20)21-24)10-11-19(4,5)13-26-15-9-7-8-12-25-15/h14-15,24H,7-13H2,1-6H3,(H2,20,21) |
| InChIKey | NGOXPINCRFSGGN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|