C14H30Se — CID 173069009
2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-ylselanyl)butane (PubChem CID 173069009) has the molecular formula C14H30Se and a molecular weight of 277.35 g/mol. Its IUPAC name is 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-ylselanyl)butane.
| Compound Name | 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-ylselanyl)butane |
|---|---|
| PubChem CID | 173069009 |
| Molecular Formula | C14H30Se |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 2,2,3-trimethyl-3-(2,3,3-trimethylbutan-2-ylselanyl)butane |
| SMILES | CC(C)(C)C(C)(C)[Se]C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H30Se/c1-11(2,3)13(7,8)15-14(9,10)12(4,5)6/h1-10H3 |
| InChIKey | YVNSMXUUMLACOW-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|