C18H30O6 — CID 173070226
1,2-bis(1,1-diethoxyethoxy)benzene (PubChem CID 173070226) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 1,2-bis(1,1-diethoxyethoxy)benzene.
| Compound Name | 1,2-bis(1,1-diethoxyethoxy)benzene |
|---|---|
| PubChem CID | 173070226 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 1,2-bis(1,1-diethoxyethoxy)benzene |
| SMILES | CCOC(C)(OCC)Oc1ccccc1OC(C)(OCC)OCC |
| InChI | InChI=1S/C18H30O6/c1-7-19-17(5,20-8-2)23-15-13-11-12-14-16(15)24-18(6,21-9-3)22-10-4/h11-14H,7-10H2,1-6H3 |
| InChIKey | ZJFIMOWMAYYOEM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|