C18H30O4 — CID 70310177
1-(1,1-diethoxypropoxy)-2-pentoxybenzene (PubChem CID 70310177) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is 1-(1,1-diethoxypropoxy)-2-pentoxybenzene.
| Compound Name | 1-(1,1-diethoxypropoxy)-2-pentoxybenzene |
|---|---|
| PubChem CID | 70310177 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 1-(1,1-diethoxypropoxy)-2-pentoxybenzene |
| SMILES | CCCCCOc1ccccc1OC(CC)(OCC)OCC |
| InChI | InChI=1S/C18H30O4/c1-5-9-12-15-19-16-13-10-11-14-17(16)22-18(6-2,20-7-3)21-8-4/h10-11,13-14H,5-9,12,15H2,1-4H3 |
| InChIKey | DBQOIFHKSAZWCI-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|