About (2-pentoxyphenyl) formate
(2-pentoxyphenyl) formate (PubChem CID 173195289) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (2-pentoxyphenyl) formate.
Molecular Properties
| Compound Name | (2-pentoxyphenyl) formate |
| PubChem CID | 173195289 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2-pentoxyphenyl) formate |
| SMILES | CCCCCOc1ccccc1OC=O |
| InChI | InChI=1S/C12H16O3/c1-2-3-6-9-14-11-7-4-5-8-12(11)15-10-13/h4-5,7-8,10H,2-3,6,9H2,1H3 |
| InChIKey | SPHRDEXOSWBRDU-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2-pentoxyphenyl) formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-pentoxyphenyl) formate?
The IUPAC name of (2-pentoxyphenyl) formate (CID 173195289) is (2-pentoxyphenyl) formate.
What is the SMILES notation for (2-pentoxyphenyl) formate?
The canonical SMILES for (2-pentoxyphenyl) formate is CCCCCOc1ccccc1OC=O.
What is the InChIKey of (2-pentoxyphenyl) formate?
The InChIKey is SPHRDEXOSWBRDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-2-3-6-9-14-11-7-4-5-8-12(11)15-10-13/h4-5,7-8,10H,2-3,6,9H2,1H3.
What are the key properties of (2-pentoxyphenyl) formate?
(2-pentoxyphenyl) formate has a molecular weight of 208.26 g/mol, XLogP of 2.79, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-pentoxyphenyl) formate is sourced from PubChem (CID 173195289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).