C23H25NO2 — CID 173070721
2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile (PubChem CID 173070721) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile.
| Compound Name | 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 173070721 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile |
| SMILES | CCCCOC=Cc1ccccc1.N#CC=CC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O.C11H9NO/c1-2-3-10-13-11-9-12-7-5-4-6-8-12;12-9-3-1-2-4-10-5-7-11(13)8-6-10/h4-9,11H,2-3,10H2,1H3;1-8,13H |
| InChIKey | OPDRHEMYDISCFR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|