About 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile
2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile (PubChem CID 173070721) has the molecular formula C23H25NO2
and a molecular weight of 347.46 g/mol. Its IUPAC name is 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile.
Molecular Properties
| Compound Name | 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile |
| PubChem CID | 173070721 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile |
| SMILES | CCCCOC=Cc1ccccc1.N#CC=CC=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H16O.C11H9NO/c1-2-3-10-13-11-9-12-7-5-4-6-8-12;12-9-3-1-2-4-10-5-7-11(13)8-6-10/h4-9,11H,2-3,10H2,1H3;1-8,13H |
| InChIKey | OPDRHEMYDISCFR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile?
The IUPAC name of 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile (CID 173070721) is 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile.
What is the SMILES notation for 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile?
The canonical SMILES for 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile is CCCCOC=Cc1ccccc1.N#CC=CC=Cc1ccc(O)cc1.
What is the InChIKey of 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile?
The InChIKey is OPDRHEMYDISCFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O.C11H9NO/c1-2-3-10-13-11-9-12-7-5-4-6-8-12;12-9-3-1-2-4-10-5-7-11(13)8-6-10/h4-9,11H,2-3,10H2,1H3;1-8,13H.
What are the key properties of 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile?
2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile has a molecular weight of 347.46 g/mol, XLogP of 5.96, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butoxyethenylbenzene;5-(4-hydroxyphenyl)penta-2,4-dienenitrile is sourced from PubChem (CID 173070721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).