C6H17N3O3Si — CID 173071554
1-N,1-N',2-N-trimethoxy-1-silylprop-2-ene-1,1,2-triamine (PubChem CID 173071554) has the molecular formula C6H17N3O3Si and a molecular weight of 207.31 g/mol. Its IUPAC name is 1-N,1-N',2-N-trimethoxy-1-silylprop-2-ene-1,1,2-triamine.
| Compound Name | 1-N,1-N',2-N-trimethoxy-1-silylprop-2-ene-1,1,2-triamine |
|---|---|
| PubChem CID | 173071554 |
| Molecular Formula | C6H17N3O3Si |
| Molecular Weight | 207.31 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1-N,1-N',2-N-trimethoxy-1-silylprop-2-ene-1,1,2-triamine |
| SMILES | C=C(NOC)C([SiH3])(NOC)NOC |
| InChI | InChI=1S/C6H17N3O3Si/c1-5(7-10-2)6(13,8-11-3)9-12-4/h7-9H,1H2,2-4,13H3 |
| InChIKey | DARXCCBJCZRNTM-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 63.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.31 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|