About 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen
1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen (PubChem CID 157365988) has the molecular formula C4H12N2O
and a molecular weight of 104.15 g/mol. Its IUPAC name is 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen.
Molecular Properties
| Compound Name | 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen |
| PubChem CID | 157365988 |
| Molecular Formula | C4H12N2O |
| Molecular Weight | 104.15 g/mol |
| Exact Mass | 104.09 |
| IUPAC Name | 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen |
| SMILES | C=C(NC)NOC.[H][H] |
| InChI | InChI=1S/C4H10N2O.H2/c1-4(5-2)6-7-3;/h5-6H,1H2,2-3H3;1H |
| InChIKey | BJELVACGWUMREN-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.15 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen?
The IUPAC name of 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen (CID 157365988) is 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen.
What is the SMILES notation for 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen?
The canonical SMILES for 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen is C=C(NC)NOC.[H][H].
What is the InChIKey of 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen?
The InChIKey is BJELVACGWUMREN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10N2O.H2/c1-4(5-2)6-7-3;/h5-6H,1H2,2-3H3;1H.
What are the key properties of 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen?
1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen has a molecular weight of 104.15 g/mol, XLogP of 0.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-methoxy-1-N-methylethene-1,1-diamine;molecular hydrogen is sourced from PubChem (CID 157365988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).