C14H28N2Si — CID 173072388
3,3-dipyrrolidin-1-ylbutyl(ethenyl)silane (PubChem CID 173072388) has the molecular formula C14H28N2Si and a molecular weight of 252.48 g/mol. Its IUPAC name is 3,3-dipyrrolidin-1-ylbutyl(ethenyl)silane.
| Compound Name | 3,3-dipyrrolidin-1-ylbutyl(ethenyl)silane |
|---|---|
| PubChem CID | 173072388 |
| Molecular Formula | C14H28N2Si |
| Molecular Weight | 252.48 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | 3,3-dipyrrolidin-1-ylbutyl(ethenyl)silane |
| SMILES | C=C[SiH2]CCC(C)(N1CCCC1)N1CCCC1 |
| InChI | InChI=1S/C14H28N2Si/c1-3-17-13-8-14(2,15-9-4-5-10-15)16-11-6-7-12-16/h3H,1,4-13,17H2,2H3 |
| InChIKey | VCHQVEWDQTTZTD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.48 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|