C10H18ClN — CID 173077168
1-penta-1,4-dien-3-ylpiperidine;hydrochloride (PubChem CID 173077168) has the molecular formula C10H18ClN and a molecular weight of 187.71 g/mol. Its IUPAC name is 1-penta-1,4-dien-3-ylpiperidine;hydrochloride.
| Compound Name | 1-penta-1,4-dien-3-ylpiperidine;hydrochloride |
|---|---|
| PubChem CID | 173077168 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-penta-1,4-dien-3-ylpiperidine;hydrochloride |
| SMILES | C=CC(C=C)N1CCCCC1.Cl |
| InChI | InChI=1S/C10H17N.ClH/c1-3-10(4-2)11-8-6-5-7-9-11;/h3-4,10H,1-2,5-9H2;1H |
| InChIKey | YFYIFRDXIJDBIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|