About 1-penta-1,4-dien-3-ylpiperidine;hydrochloride
1-penta-1,4-dien-3-ylpiperidine;hydrochloride (PubChem CID 173077168) has the molecular formula C10H18ClN
and a molecular weight of 187.71 g/mol. Its IUPAC name is 1-penta-1,4-dien-3-ylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | 1-penta-1,4-dien-3-ylpiperidine;hydrochloride |
| PubChem CID | 173077168 |
| Molecular Formula | C10H18ClN |
| Molecular Weight | 187.71 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 1-penta-1,4-dien-3-ylpiperidine;hydrochloride |
| SMILES | C=CC(C=C)N1CCCCC1.Cl |
| InChI | InChI=1S/C10H17N.ClH/c1-3-10(4-2)11-8-6-5-7-9-11;/h3-4,10H,1-2,5-9H2;1H |
| InChIKey | YFYIFRDXIJDBIX-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.71 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-penta-1,4-dien-3-ylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-penta-1,4-dien-3-ylpiperidine;hydrochloride?
The IUPAC name of 1-penta-1,4-dien-3-ylpiperidine;hydrochloride (CID 173077168) is 1-penta-1,4-dien-3-ylpiperidine;hydrochloride.
What is the SMILES notation for 1-penta-1,4-dien-3-ylpiperidine;hydrochloride?
The canonical SMILES for 1-penta-1,4-dien-3-ylpiperidine;hydrochloride is C=CC(C=C)N1CCCCC1.Cl.
What is the InChIKey of 1-penta-1,4-dien-3-ylpiperidine;hydrochloride?
The InChIKey is YFYIFRDXIJDBIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N.ClH/c1-3-10(4-2)11-8-6-5-7-9-11;/h3-4,10H,1-2,5-9H2;1H.
What are the key properties of 1-penta-1,4-dien-3-ylpiperidine;hydrochloride?
1-penta-1,4-dien-3-ylpiperidine;hydrochloride has a molecular weight of 187.71 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-penta-1,4-dien-3-ylpiperidine;hydrochloride is sourced from PubChem (CID 173077168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).