sodium;hydride;thiophene-2-sulfinic acid

C4H5NaO2S2 — CID 173077557

IUPACsodium;hydride;thiophene-2-sulfinic acid
SMILESO=S(O)c1cccs1.[H-].[Na+]
InChIInChI=1S/C4H4O2S2.Na.H/c5-8(6)4-2-1-3-7-4;;/h1-3H,(H,5,6);;/q;+1;-1
InChIKeyDPLSAQNXCBOMHJ-UHFFFAOYSA-N
MW172.21 g/mol
LogP-1.55
Rot. Bonds1

About sodium;hydride;thiophene-2-sulfinic acid

sodium;hydride;thiophene-2-sulfinic acid (PubChem CID 173077557) has the molecular formula C4H5NaO2S2 and a molecular weight of 172.21 g/mol. Its IUPAC name is sodium;hydride;thiophene-2-sulfinic acid.

Molecular Properties

Compound Namesodium;hydride;thiophene-2-sulfinic acid
PubChem CID173077557
Molecular FormulaC4H5NaO2S2
Molecular Weight172.21 g/mol
Exact Mass171.96
IUPAC Namesodium;hydride;thiophene-2-sulfinic acid
SMILESO=S(O)c1cccs1.[H-].[Na+]
InChIInChI=1S/C4H4O2S2.Na.H/c5-8(6)4-2-1-3-7-4;;/h1-3H,(H,5,6);;/q;+1;-1
InChIKeyDPLSAQNXCBOMHJ-UHFFFAOYSA-N
XLogP-1.55
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.21
LogP ≤ 5-1.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze sodium;hydride;thiophene-2-sulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of sodium;hydride;thiophene-2-sulfinic acid?
The IUPAC name of sodium;hydride;thiophene-2-sulfinic acid (CID 173077557) is sodium;hydride;thiophene-2-sulfinic acid.
What is the SMILES notation for sodium;hydride;thiophene-2-sulfinic acid?
The canonical SMILES for sodium;hydride;thiophene-2-sulfinic acid is O=S(O)c1cccs1.[H-].[Na+].
What is the InChIKey of sodium;hydride;thiophene-2-sulfinic acid?
The InChIKey is DPLSAQNXCBOMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O2S2.Na.H/c5-8(6)4-2-1-3-7-4;;/h1-3H,(H,5,6);;/q;+1;-1.
What are the key properties of sodium;hydride;thiophene-2-sulfinic acid?
sodium;hydride;thiophene-2-sulfinic acid has a molecular weight of 172.21 g/mol, XLogP of -1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;thiophene-2-sulfinic acid is sourced from PubChem (CID 173077557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).