About sodium;hydride;thiophene-2-sulfinic acid
sodium;hydride;thiophene-2-sulfinic acid (PubChem CID 173077557) has the molecular formula C4H5NaO2S2
and a molecular weight of 172.21 g/mol. Its IUPAC name is sodium;hydride;thiophene-2-sulfinic acid.
Molecular Properties
| Compound Name | sodium;hydride;thiophene-2-sulfinic acid |
| PubChem CID | 173077557 |
| Molecular Formula | C4H5NaO2S2 |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 171.96 |
| IUPAC Name | sodium;hydride;thiophene-2-sulfinic acid |
| SMILES | O=S(O)c1cccs1.[H-].[Na+] |
| InChI | InChI=1S/C4H4O2S2.Na.H/c5-8(6)4-2-1-3-7-4;;/h1-3H,(H,5,6);;/q;+1;-1 |
| InChIKey | DPLSAQNXCBOMHJ-UHFFFAOYSA-N |
| XLogP | -1.55 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;thiophene-2-sulfinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;thiophene-2-sulfinic acid?
The IUPAC name of sodium;hydride;thiophene-2-sulfinic acid (CID 173077557) is sodium;hydride;thiophene-2-sulfinic acid.
What is the SMILES notation for sodium;hydride;thiophene-2-sulfinic acid?
The canonical SMILES for sodium;hydride;thiophene-2-sulfinic acid is O=S(O)c1cccs1.[H-].[Na+].
What is the InChIKey of sodium;hydride;thiophene-2-sulfinic acid?
The InChIKey is DPLSAQNXCBOMHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4O2S2.Na.H/c5-8(6)4-2-1-3-7-4;;/h1-3H,(H,5,6);;/q;+1;-1.
What are the key properties of sodium;hydride;thiophene-2-sulfinic acid?
sodium;hydride;thiophene-2-sulfinic acid has a molecular weight of 172.21 g/mol, XLogP of -1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;thiophene-2-sulfinic acid is sourced from PubChem (CID 173077557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).