C13H16Cl2N2O — CID 173077623
2-(2,4-dichloroanilino)-1-piperidin-3-ylethanone (PubChem CID 173077623) has the molecular formula C13H16Cl2N2O and a molecular weight of 287.19 g/mol. Its IUPAC name is 2-(2,4-dichloroanilino)-1-piperidin-3-ylethanone.
| Compound Name | 2-(2,4-dichloroanilino)-1-piperidin-3-ylethanone |
|---|---|
| PubChem CID | 173077623 |
| Molecular Formula | C13H16Cl2N2O |
| Molecular Weight | 287.19 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(2,4-dichloroanilino)-1-piperidin-3-ylethanone |
| SMILES | O=C(CNc1ccc(Cl)cc1Cl)C1CCCNC1 |
| InChI | InChI=1S/C13H16Cl2N2O/c14-10-3-4-12(11(15)6-10)17-8-13(18)9-2-1-5-16-7-9/h3-4,6,9,16-17H,1-2,5,7-8H2 |
| InChIKey | SMYDUEVRARWEBH-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |