C11H25NOSi — CID 173078593
6-ethoxysilyl-4,6-dimethylhept-3-en-1-amine (PubChem CID 173078593) has the molecular formula C11H25NOSi and a molecular weight of 215.41 g/mol. Its IUPAC name is 6-ethoxysilyl-4,6-dimethylhept-3-en-1-amine.
| Compound Name | 6-ethoxysilyl-4,6-dimethylhept-3-en-1-amine |
|---|---|
| PubChem CID | 173078593 |
| Molecular Formula | C11H25NOSi |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 6-ethoxysilyl-4,6-dimethylhept-3-en-1-amine |
| SMILES | CCO[SiH2]C(C)(C)CC(C)=CCCN |
| InChI | InChI=1S/C11H25NOSi/c1-5-13-14-11(3,4)9-10(2)7-6-8-12/h7H,5-6,8-9,12,14H2,1-4H3 |
| InChIKey | VKQMKQAPPRLNMX-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|