C11H20N2 — CID 173078604
3,5-bis(2-methylpropyl)-3H-pyrazole (PubChem CID 173078604) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is 3,5-bis(2-methylpropyl)-3H-pyrazole.
| Compound Name | 3,5-bis(2-methylpropyl)-3H-pyrazole |
|---|---|
| PubChem CID | 173078604 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | 3,5-bis(2-methylpropyl)-3H-pyrazole |
| SMILES | CC(C)CC1=CC(CC(C)C)N=N1 |
| InChI | InChI=1S/C11H20N2/c1-8(2)5-10-7-11(13-12-10)6-9(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | LXSQHQCGDAZYOJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |