C14H25N2+ — CID 123507402
but-3-en-2-ylimino-methyl-(6-methylocta-2,7-dien-2-yl)azanium (PubChem CID 123507402) has the molecular formula C14H25N2+ and a molecular weight of 221.37 g/mol. Its IUPAC name is but-3-en-2-ylimino-methyl-(6-methylocta-2,7-dien-2-yl)azanium.
| Compound Name | but-3-en-2-ylimino-methyl-(6-methylocta-2,7-dien-2-yl)azanium |
|---|---|
| PubChem CID | 123507402 |
| Molecular Formula | C14H25N2+ |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.20 |
| IUPAC Name | but-3-en-2-ylimino-methyl-(6-methylocta-2,7-dien-2-yl)azanium |
| SMILES | C=CC(C)CCC=C(C)/[N+](C)=N/C(C)C=C |
| InChI | InChI=1S/C14H25N2/c1-7-12(3)10-9-11-14(5)16(6)15-13(4)8-2/h7-8,11-13H,1-2,9-10H2,3-6H3/q+1/b14-11?,16-15+ |
| InChIKey | QQIMDWJXZZJQQC-BHQAMNFOSA-N |
| XLogP | 4.16 |
| TPSA | 15.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|