C11H22N2 — CID 176934454
[(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene (PubChem CID 176934454) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene.
| Compound Name | [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene |
|---|---|
| PubChem CID | 176934454 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene |
| SMILES | C/N=N/C(=C\CCC(C)C)C(C)C |
| InChI | InChI=1S/C11H22N2/c1-9(2)7-6-8-11(10(3)4)13-12-5/h8-10H,6-7H2,1-5H3/b11-8-,13-12+ |
| InChIKey | CWYVEVVMBQZYSS-STZLXFPOSA-N |
| XLogP | 4.04 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|