C11H20N2 — CID 145320881
methyl-[(3Z)-2,5,5-trimethylhepta-3,6-dien-3-yl]diazene (PubChem CID 145320881) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is methyl-[(3Z)-2,5,5-trimethylhepta-3,6-dien-3-yl]diazene.
| Compound Name | methyl-[(3Z)-2,5,5-trimethylhepta-3,6-dien-3-yl]diazene |
|---|---|
| PubChem CID | 145320881 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | methyl-[(3Z)-2,5,5-trimethylhepta-3,6-dien-3-yl]diazene |
| SMILES | C=CC(C)(C)/C=C(\N=N\C)C(C)C |
| InChI | InChI=1S/C11H20N2/c1-7-11(4,5)8-10(9(2)3)13-12-6/h7-9H,1H2,2-6H3/b10-8-,13-12+ |
| InChIKey | NVPJNHCMCOUHAN-GMXJUQNMSA-N |
| XLogP | 3.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|