C13H24N2 — CID 134199567
3,3-dimethylbut-1-en-2-yl-[(Z)-4,4-dimethylpent-2-en-3-yl]diazene (PubChem CID 134199567) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 3,3-dimethylbut-1-en-2-yl-[(Z)-4,4-dimethylpent-2-en-3-yl]diazene.
| Compound Name | 3,3-dimethylbut-1-en-2-yl-[(Z)-4,4-dimethylpent-2-en-3-yl]diazene |
|---|---|
| PubChem CID | 134199567 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 3,3-dimethylbut-1-en-2-yl-[(Z)-4,4-dimethylpent-2-en-3-yl]diazene |
| SMILES | C=C(/N=N/C(=C\C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C13H24N2/c1-9-11(13(6,7)8)15-14-10(2)12(3,4)5/h9H,2H2,1,3-8H3/b11-9-,15-14+ |
| InChIKey | PKXKLWDTYCOYSH-DVRQTUGZSA-N |
| XLogP | 4.95 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|