C7H13N3 — CID 134986194
(E)-2-azido-4,4-dimethylpent-2-ene (PubChem CID 134986194) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (E)-2-azido-4,4-dimethylpent-2-ene.
| Compound Name | (E)-2-azido-4,4-dimethylpent-2-ene |
|---|---|
| PubChem CID | 134986194 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (E)-2-azido-4,4-dimethylpent-2-ene |
| SMILES | C/C(=C\C(C)(C)C)N=[N+]=[N-] |
| InChI | InChI=1S/C7H13N3/c1-6(9-10-8)5-7(2,3)4/h5H,1-4H3/b6-5+ |
| InChIKey | HITITIGANZYMCD-AATRIKPKSA-N |
| XLogP | 3.25 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|