C12H23N — CID 59179886
(Z)-N-tert-butyl-2,4,4-trimethylpent-2-en-1-imine (PubChem CID 59179886) has the molecular formula C12H23N and a molecular weight of 181.32 g/mol. Its IUPAC name is (Z)-N-tert-butyl-2,4,4-trimethylpent-2-en-1-imine.
| Compound Name | (Z)-N-tert-butyl-2,4,4-trimethylpent-2-en-1-imine |
|---|---|
| PubChem CID | 59179886 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | (Z)-N-tert-butyl-2,4,4-trimethylpent-2-en-1-imine |
| SMILES | CC(=C/C(C)(C)C)/C=N/C(C)(C)C |
| InChI | InChI=1S/C12H23N/c1-10(8-11(2,3)4)9-13-12(5,6)7/h8-9H,1-7H3/b10-8-,13-9+ |
| InChIKey | FXINKVWAYBDQIM-KKCPJAHZSA-N |
| XLogP | 3.85 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|