C13H26N2 — CID 176934453
[(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene;ethene (PubChem CID 176934453) has the molecular formula C13H26N2 and a molecular weight of 210.36 g/mol. Its IUPAC name is [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene;ethene.
| Compound Name | [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene;ethene |
|---|---|
| PubChem CID | 176934453 |
| Molecular Formula | C13H26N2 |
| Molecular Weight | 210.36 g/mol |
| Exact Mass | 210.21 |
| IUPAC Name | [(Z)-2,7-dimethyloct-3-en-3-yl]-methyldiazene;ethene |
| SMILES | C/N=N/C(=C\CCC(C)C)C(C)C.C=C |
| InChI | InChI=1S/C11H22N2.C2H4/c1-9(2)7-6-8-11(10(3)4)13-12-5;1-2/h8-10H,6-7H2,1-5H3;1-2H2/b11-8-,13-12+; |
| InChIKey | PBXMNKIEVVDKJR-NYFBCZETSA-N |
| XLogP | 4.85 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|