C10H9FN4O — CID 173080430
2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide (PubChem CID 173080430) has the molecular formula C10H9FN4O and a molecular weight of 220.21 g/mol. Its IUPAC name is 2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide.
| Compound Name | 2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 173080430 |
| Molecular Formula | C10H9FN4O |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-[2-fluoro-4-(1,2,4-triazol-1-yl)phenyl]acetamide |
| SMILES | NC(=O)Cc1ccc(-n2cncn2)cc1F |
| InChI | InChI=1S/C10H9FN4O/c11-9-4-8(15-6-13-5-14-15)2-1-7(9)3-10(12)16/h1-2,4-6H,3H2,(H2,12,16) |
| InChIKey | GTVIVWLLOYQJME-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |